C10H12N2O2 — CID 117042628
2-[methyl(pyridin-4-yl)amino]cyclopropane-1-carboxylic acid (PubChem CID 117042628) has the molecular formula C10H12N2O2 and a molecular weight of 192.22 g/mol. Its IUPAC name is 2-[methyl(pyridin-4-yl)amino]cyclopropane-1-carboxylic acid.
| Compound Name | 2-[methyl(pyridin-4-yl)amino]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 117042628 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | 2-[methyl(pyridin-4-yl)amino]cyclopropane-1-carboxylic acid |
| SMILES | CN(c1ccncc1)C1CC1C(=O)O |
| InChI | InChI=1S/C10H12N2O2/c1-12(7-2-4-11-5-3-7)9-6-8(9)10(13)14/h2-5,8-9H,6H2,1H3,(H,13,14) |
| InChIKey | ZRHVYPFSNMVNTK-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |