C14H13FN2O — CID 106934866
4-fluoro-N,2-dimethyl-N-pyridin-4-ylbenzamide (PubChem CID 106934866) has the molecular formula C14H13FN2O and a molecular weight of 244.27 g/mol. Its IUPAC name is 4-fluoro-N,2-dimethyl-N-pyridin-4-ylbenzamide.
| Compound Name | 4-fluoro-N,2-dimethyl-N-pyridin-4-ylbenzamide |
|---|---|
| PubChem CID | 106934866 |
| Molecular Formula | C14H13FN2O |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 4-fluoro-N,2-dimethyl-N-pyridin-4-ylbenzamide |
| SMILES | Cc1cc(F)ccc1C(=O)N(C)c1ccncc1 |
| InChI | InChI=1S/C14H13FN2O/c1-10-9-11(15)3-4-13(10)14(18)17(2)12-5-7-16-8-6-12/h3-9H,1-2H3 |
| InChIKey | JZWBIUIWQWMQJM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |