C16H17N3O — CID 106935509
N-ethyl-N-pyridin-4-yl-2,3-dihydro-1H-indole-3-carboxamide (PubChem CID 106935509) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is N-ethyl-N-pyridin-4-yl-2,3-dihydro-1H-indole-3-carboxamide.
| Compound Name | N-ethyl-N-pyridin-4-yl-2,3-dihydro-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 106935509 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | N-ethyl-N-pyridin-4-yl-2,3-dihydro-1H-indole-3-carboxamide |
| SMILES | CCN(C(=O)C1CNc2ccccc21)c1ccncc1 |
| InChI | InChI=1S/C16H17N3O/c1-2-19(12-7-9-17-10-8-12)16(20)14-11-18-15-6-4-3-5-13(14)15/h3-10,14,18H,2,11H2,1H3 |
| InChIKey | RWSLBOHFFBFQCG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |