3-[2,3-dihydro-1H-indole-3-carbonyl(ethyl)amino]butanoic acid

C15H20N2O3 — CID 80566466

IUPAC3-[2,3-dihydro-1H-indole-3-carbonyl(ethyl)amino]butanoic acid
SMILESCCN(C(=O)C1CNc2ccccc21)C(C)CC(=O)O
InChIInChI=1S/C15H20N2O3/c1-3-17(10(2)8-14(18)19)15(20)12-9-16-13-7-5-4-6-11(12)13/h4-7,10,12,16H,3,8-9H2,1-2H3,(H,18,19)
InChIKeyDCCYRQXESUBYMZ-UHFFFAOYSA-N
MW276.34 g/mol
LogP1.91
Rot. Bonds5

About 3-[2,3-dihydro-1H-indole-3-carbonyl(ethyl)amino]butanoic acid

3-[2,3-dihydro-1H-indole-3-carbonyl(ethyl)amino]butanoic acid (PubChem CID 80566466) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-[2,3-dihydro-1H-indole-3-carbonyl(ethyl)amino]butanoic acid.

Molecular Properties

Compound Name3-[2,3-dihydro-1H-indole-3-carbonyl(ethyl)amino]butanoic acid
PubChem CID80566466
Molecular FormulaC15H20N2O3
Molecular Weight276.34 g/mol
Exact Mass276.15
IUPAC Name3-[2,3-dihydro-1H-indole-3-carbonyl(ethyl)amino]butanoic acid
SMILESCCN(C(=O)C1CNc2ccccc21)C(C)CC(=O)O
InChIInChI=1S/C15H20N2O3/c1-3-17(10(2)8-14(18)19)15(20)12-9-16-13-7-5-4-6-11(12)13/h4-7,10,12,16H,3,8-9H2,1-2H3,(H,18,19)
InChIKeyDCCYRQXESUBYMZ-UHFFFAOYSA-N
XLogP1.91
TPSA69.64 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500276.34
LogP ≤ 51.91
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-[2,3-dihydro-1H-indole-3-carbonyl(ethyl)amino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2,3-dihydro-1H-indole-3-carbonyl(ethyl)amino]butanoic acid?
The IUPAC name of 3-[2,3-dihydro-1H-indole-3-carbonyl(ethyl)amino]butanoic acid (CID 80566466) is 3-[2,3-dihydro-1H-indole-3-carbonyl(ethyl)amino]butanoic acid.
What is the SMILES notation for 3-[2,3-dihydro-1H-indole-3-carbonyl(ethyl)amino]butanoic acid?
The canonical SMILES for 3-[2,3-dihydro-1H-indole-3-carbonyl(ethyl)amino]butanoic acid is CCN(C(=O)C1CNc2ccccc21)C(C)CC(=O)O.
What is the InChIKey of 3-[2,3-dihydro-1H-indole-3-carbonyl(ethyl)amino]butanoic acid?
The InChIKey is DCCYRQXESUBYMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3/c1-3-17(10(2)8-14(18)19)15(20)12-9-16-13-7-5-4-6-11(12)13/h4-7,10,12,16H,3,8-9H2,1-2H3,(H,18,19).
What are the key properties of 3-[2,3-dihydro-1H-indole-3-carbonyl(ethyl)amino]butanoic acid?
3-[2,3-dihydro-1H-indole-3-carbonyl(ethyl)amino]butanoic acid has a molecular weight of 276.34 g/mol, XLogP of 1.91, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,3-dihydro-1H-indole-3-carbonyl(ethyl)amino]butanoic acid is sourced from PubChem (CID 80566466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).