C21H33N3O4S — CID 10693592
(2R,4S)-N-hydroxy-1-(4-pentylphenyl)sulfonyl-4-piperidin-1-ylpyrrolidine-2-carboxamide (PubChem CID 10693592) has the molecular formula C21H33N3O4S and a molecular weight of 423.58 g/mol. Its IUPAC name is (2R,4S)-N-hydroxy-1-(4-pentylphenyl)sulfonyl-4-piperidin-1-ylpyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-N-hydroxy-1-(4-pentylphenyl)sulfonyl-4-piperidin-1-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10693592 |
| Molecular Formula | C21H33N3O4S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | (2R,4S)-N-hydroxy-1-(4-pentylphenyl)sulfonyl-4-piperidin-1-ylpyrrolidine-2-carboxamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)N2C[C@@H](N3CCCCC3)C[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C21H33N3O4S/c1-2-3-5-8-17-9-11-19(12-10-17)29(27,28)24-16-18(15-20(24)21(25)22-26)23-13-6-4-7-14-23/h9-12,18,20,26H,2-8,13-16H2,1H3,(H,22,25)/t18-,20+/m0/s1 |
| InChIKey | HDBHDPIRGZHXCM-AZUAARDMSA-N |
| XLogP | 2.54 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|