C20H31N3O5S — CID 10764871
(2R,4S)-N-hydroxy-4-morpholin-4-yl-1-(4-pentylphenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 10764871) has the molecular formula C20H31N3O5S and a molecular weight of 425.55 g/mol. Its IUPAC name is (2R,4S)-N-hydroxy-4-morpholin-4-yl-1-(4-pentylphenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-N-hydroxy-4-morpholin-4-yl-1-(4-pentylphenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10764871 |
| Molecular Formula | C20H31N3O5S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (2R,4S)-N-hydroxy-4-morpholin-4-yl-1-(4-pentylphenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)N2C[C@@H](N3CCOCC3)C[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C20H31N3O5S/c1-2-3-4-5-16-6-8-18(9-7-16)29(26,27)23-15-17(14-19(23)20(24)21-25)22-10-12-28-13-11-22/h6-9,17,19,25H,2-5,10-15H2,1H3,(H,21,24)/t17-,19+/m0/s1 |
| InChIKey | OQWMKRBWGAJEGE-PKOBYXMFSA-N |
| XLogP | 1.39 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|