C12H15N3O4 — CID 106936138
4-[[ethyl(pyridin-4-yl)carbamoyl]amino]-4-oxobutanoic acid (PubChem CID 106936138) has the molecular formula C12H15N3O4 and a molecular weight of 265.27 g/mol. Its IUPAC name is 4-[[ethyl(pyridin-4-yl)carbamoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[ethyl(pyridin-4-yl)carbamoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 106936138 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-[[ethyl(pyridin-4-yl)carbamoyl]amino]-4-oxobutanoic acid |
| SMILES | CCN(C(=O)NC(=O)CCC(=O)O)c1ccncc1 |
| InChI | InChI=1S/C12H15N3O4/c1-2-15(9-5-7-13-8-6-9)12(19)14-10(16)3-4-11(17)18/h5-8H,2-4H2,1H3,(H,17,18)(H,14,16,19) |
| InChIKey | YJBATBCZYAJWCN-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |