C11H17N3O4S — CID 106934719
3-[[ethyl(pyridin-4-yl)sulfamoyl]-methylamino]propanoic acid (PubChem CID 106934719) has the molecular formula C11H17N3O4S and a molecular weight of 287.34 g/mol. Its IUPAC name is 3-[[ethyl(pyridin-4-yl)sulfamoyl]-methylamino]propanoic acid.
| Compound Name | 3-[[ethyl(pyridin-4-yl)sulfamoyl]-methylamino]propanoic acid |
|---|---|
| PubChem CID | 106934719 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-[[ethyl(pyridin-4-yl)sulfamoyl]-methylamino]propanoic acid |
| SMILES | CCN(c1ccncc1)S(=O)(=O)N(C)CCC(=O)O |
| InChI | InChI=1S/C11H17N3O4S/c1-3-14(10-4-7-12-8-5-10)19(17,18)13(2)9-6-11(15)16/h4-5,7-8H,3,6,9H2,1-2H3,(H,15,16) |
| InChIKey | DVNJQXZBVDJZPW-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |