C24H28N2O5 — CID 10693617
tert-butyl N-[(Z)-[2-(3,5-dimethoxybenzoyl)-3,4-dihydro-2H-naphthalen-1-ylidene]amino]carbamate (PubChem CID 10693617) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is tert-butyl N-[(Z)-[2-(3,5-dimethoxybenzoyl)-3,4-dihydro-2H-naphthalen-1-ylidene]amino]carbamate.
| Compound Name | tert-butyl N-[(Z)-[2-(3,5-dimethoxybenzoyl)-3,4-dihydro-2H-naphthalen-1-ylidene]amino]carbamate |
|---|---|
| PubChem CID | 10693617 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | tert-butyl N-[(Z)-[2-(3,5-dimethoxybenzoyl)-3,4-dihydro-2H-naphthalen-1-ylidene]amino]carbamate |
| SMILES | COc1cc(OC)cc(C(=O)C2CCc3ccccc3/C2=N\NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C24H28N2O5/c1-24(2,3)31-23(28)26-25-21-19-9-7-6-8-15(19)10-11-20(21)22(27)16-12-17(29-4)14-18(13-16)30-5/h6-9,12-14,20H,10-11H2,1-5H3,(H,26,28)/b25-21+ |
| InChIKey | HQYBLGGLNMYIPJ-NJNXFGOHSA-N |
| XLogP | 4.38 |
| TPSA | 86.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|