C10H17N3O — CID 106937227
3-[(1-ethenylpyrazol-4-yl)methylamino]butan-1-ol (PubChem CID 106937227) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 3-[(1-ethenylpyrazol-4-yl)methylamino]butan-1-ol.
| Compound Name | 3-[(1-ethenylpyrazol-4-yl)methylamino]butan-1-ol |
|---|---|
| PubChem CID | 106937227 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 3-[(1-ethenylpyrazol-4-yl)methylamino]butan-1-ol |
| SMILES | C=Cn1cc(CNC(C)CCO)cn1 |
| InChI | InChI=1S/C10H17N3O/c1-3-13-8-10(7-12-13)6-11-9(2)4-5-14/h3,7-9,11,14H,1,4-6H2,2H3 |
| InChIKey | JAFYAEGUZMHWHT-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |