C11H19N3S — CID 106937397
N-[(1-ethenylpyrazol-4-yl)methyl]-1-ethylsulfanylpropan-2-amine (PubChem CID 106937397) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is N-[(1-ethenylpyrazol-4-yl)methyl]-1-ethylsulfanylpropan-2-amine.
| Compound Name | N-[(1-ethenylpyrazol-4-yl)methyl]-1-ethylsulfanylpropan-2-amine |
|---|---|
| PubChem CID | 106937397 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-[(1-ethenylpyrazol-4-yl)methyl]-1-ethylsulfanylpropan-2-amine |
| SMILES | C=Cn1cc(CNC(C)CSCC)cn1 |
| InChI | InChI=1S/C11H19N3S/c1-4-14-8-11(7-13-14)6-12-10(3)9-15-5-2/h4,7-8,10,12H,1,5-6,9H2,2-3H3 |
| InChIKey | JZRYIGSUUOSIQX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |