C14H10BrF3O — CID 106941187
1-(3-bromo-2,6-difluorophenyl)-1-(4-fluorophenyl)ethanol (PubChem CID 106941187) has the molecular formula C14H10BrF3O and a molecular weight of 331.13 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-1-(4-fluorophenyl)ethanol.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-1-(4-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 106941187 |
| Molecular Formula | C14H10BrF3O |
| Molecular Weight | 331.13 g/mol |
| Exact Mass | 329.99 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-1-(4-fluorophenyl)ethanol |
| SMILES | CC(O)(c1ccc(F)cc1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C14H10BrF3O/c1-14(19,8-2-4-9(16)5-3-8)12-11(17)7-6-10(15)13(12)18/h2-7,19H,1H3 |
| InChIKey | DQQMYADGYSACRW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.13 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|