C9H7BrF5NO — CID 106943453
3-amino-2-(3-bromo-2,6-difluorophenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 106943453) has the molecular formula C9H7BrF5NO and a molecular weight of 320.06 g/mol. Its IUPAC name is 3-amino-2-(3-bromo-2,6-difluorophenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-amino-2-(3-bromo-2,6-difluorophenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 106943453 |
| Molecular Formula | C9H7BrF5NO |
| Molecular Weight | 320.06 g/mol |
| Exact Mass | 318.96 |
| IUPAC Name | 3-amino-2-(3-bromo-2,6-difluorophenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | NCC(O)(c1c(F)ccc(Br)c1F)C(F)(F)F |
| InChI | InChI=1S/C9H7BrF5NO/c10-4-1-2-5(11)6(7(4)12)8(17,3-16)9(13,14)15/h1-2,17H,3,16H2 |
| InChIKey | SCTLRRLVHWTZLL-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.06 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|