C14H11BrF3N — CID 106943960
2-(3-bromo-2,6-difluorophenyl)-2-fluoro-2-phenylethanamine (PubChem CID 106943960) has the molecular formula C14H11BrF3N and a molecular weight of 330.15 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-2-fluoro-2-phenylethanamine.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-2-fluoro-2-phenylethanamine |
|---|---|
| PubChem CID | 106943960 |
| Molecular Formula | C14H11BrF3N |
| Molecular Weight | 330.15 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-2-fluoro-2-phenylethanamine |
| SMILES | NCC(F)(c1ccccc1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C14H11BrF3N/c15-10-6-7-11(16)12(13(10)17)14(18,8-19)9-4-2-1-3-5-9/h1-7H,8,19H2 |
| InChIKey | LNQXLYFNEPTSPL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.15 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|