C9H7F6NO — CID 63081377
3-amino-1,1,1-trifluoro-2-(2,3,4-trifluorophenyl)propan-2-ol (PubChem CID 63081377) has the molecular formula C9H7F6NO and a molecular weight of 259.15 g/mol. Its IUPAC name is 3-amino-1,1,1-trifluoro-2-(2,3,4-trifluorophenyl)propan-2-ol.
| Compound Name | 3-amino-1,1,1-trifluoro-2-(2,3,4-trifluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 63081377 |
| Molecular Formula | C9H7F6NO |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 3-amino-1,1,1-trifluoro-2-(2,3,4-trifluorophenyl)propan-2-ol |
| SMILES | NCC(O)(c1ccc(F)c(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C9H7F6NO/c10-5-2-1-4(6(11)7(5)12)8(17,3-16)9(13,14)15/h1-2,17H,3,16H2 |
| InChIKey | XTINATMOMFWVCK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|