C10H9F5O — CID 83950267
2-(2,3-difluorophenyl)-1,1,1-trifluorobutan-2-ol (PubChem CID 83950267) has the molecular formula C10H9F5O and a molecular weight of 240.17 g/mol. Its IUPAC name is 2-(2,3-difluorophenyl)-1,1,1-trifluorobutan-2-ol.
| Compound Name | 2-(2,3-difluorophenyl)-1,1,1-trifluorobutan-2-ol |
|---|---|
| PubChem CID | 83950267 |
| Molecular Formula | C10H9F5O |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 2-(2,3-difluorophenyl)-1,1,1-trifluorobutan-2-ol |
| SMILES | CCC(O)(c1cccc(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C10H9F5O/c1-2-9(16,10(13,14)15)6-4-3-5-7(11)8(6)12/h3-5,16H,2H2,1H3 |
| InChIKey | LVQWYJGMIVJUAV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |