C15H17BrF2N2O — CID 106941468
(3-bromo-2,6-difluorophenyl)-(3-tert-butyl-1-methylpyrazol-4-yl)methanol (PubChem CID 106941468) has the molecular formula C15H17BrF2N2O and a molecular weight of 359.21 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)-(3-tert-butyl-1-methylpyrazol-4-yl)methanol.
| Compound Name | (3-bromo-2,6-difluorophenyl)-(3-tert-butyl-1-methylpyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 106941468 |
| Molecular Formula | C15H17BrF2N2O |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)-(3-tert-butyl-1-methylpyrazol-4-yl)methanol |
| SMILES | Cn1cc(C(O)c2c(F)ccc(Br)c2F)c(C(C)(C)C)n1 |
| InChI | InChI=1S/C15H17BrF2N2O/c1-15(2,3)14-8(7-20(4)19-14)13(21)11-10(17)6-5-9(16)12(11)18/h5-7,13,21H,1-4H3 |
| InChIKey | LSAIIOJXCHLSBT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|