C26H26O2S2 — CID 10694148
(1S,2R)-1,2-bis(5-ethylthiophen-2-yl)-1,2-diphenylethane-1,2-diol (PubChem CID 10694148) has the molecular formula C26H26O2S2 and a molecular weight of 434.63 g/mol. Its IUPAC name is (1S,2R)-1,2-bis(5-ethylthiophen-2-yl)-1,2-diphenylethane-1,2-diol.
| Compound Name | (1S,2R)-1,2-bis(5-ethylthiophen-2-yl)-1,2-diphenylethane-1,2-diol |
|---|---|
| PubChem CID | 10694148 |
| Molecular Formula | C26H26O2S2 |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | (1S,2R)-1,2-bis(5-ethylthiophen-2-yl)-1,2-diphenylethane-1,2-diol |
| SMILES | CCc1ccc([C@](O)(c2ccccc2)[C@](O)(c2ccccc2)c2ccc(CC)s2)s1 |
| InChI | InChI=1S/C26H26O2S2/c1-3-21-15-17-23(29-21)25(27,19-11-7-5-8-12-19)26(28,20-13-9-6-10-14-20)24-18-16-22(4-2)30-24/h5-18,27-28H,3-4H2,1-2H3/t25-,26+ |
| InChIKey | CDVUUELMDLJYLO-WMPKNSHKSA-N |
| XLogP | 6.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |