C12H8BrClF2N2 — CID 106943648
4-(3-bromo-2,6-difluorophenyl)-6-chloro-5-ethylpyrimidine (PubChem CID 106943648) has the molecular formula C12H8BrClF2N2 and a molecular weight of 333.56 g/mol. Its IUPAC name is 4-(3-bromo-2,6-difluorophenyl)-6-chloro-5-ethylpyrimidine.
| Compound Name | 4-(3-bromo-2,6-difluorophenyl)-6-chloro-5-ethylpyrimidine |
|---|---|
| PubChem CID | 106943648 |
| Molecular Formula | C12H8BrClF2N2 |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 4-(3-bromo-2,6-difluorophenyl)-6-chloro-5-ethylpyrimidine |
| SMILES | CCc1c(Cl)ncnc1-c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C12H8BrClF2N2/c1-2-6-11(17-5-18-12(6)14)9-8(15)4-3-7(13)10(9)16/h3-5H,2H2,1H3 |
| InChIKey | PFJMVNZWBLPKHL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|