C13H10BrClF2N2O — CID 106943650
4-(3-bromo-2,6-difluorophenyl)-6-chloro-2-(ethoxymethyl)pyrimidine (PubChem CID 106943650) has the molecular formula C13H10BrClF2N2O and a molecular weight of 363.59 g/mol. Its IUPAC name is 4-(3-bromo-2,6-difluorophenyl)-6-chloro-2-(ethoxymethyl)pyrimidine.
| Compound Name | 4-(3-bromo-2,6-difluorophenyl)-6-chloro-2-(ethoxymethyl)pyrimidine |
|---|---|
| PubChem CID | 106943650 |
| Molecular Formula | C13H10BrClF2N2O |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 361.96 |
| IUPAC Name | 4-(3-bromo-2,6-difluorophenyl)-6-chloro-2-(ethoxymethyl)pyrimidine |
| SMILES | CCOCc1nc(Cl)cc(-c2c(F)ccc(Br)c2F)n1 |
| InChI | InChI=1S/C13H10BrClF2N2O/c1-2-20-6-11-18-9(5-10(15)19-11)12-8(16)4-3-7(14)13(12)17/h3-5H,2,6H2,1H3 |
| InChIKey | UONJKTWWJCATBF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|