C11H4BrF5N2O — CID 136767104
4-(3-bromo-2,6-difluorophenyl)-2-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 136767104) has the molecular formula C11H4BrF5N2O and a molecular weight of 355.06 g/mol. Its IUPAC name is 4-(3-bromo-2,6-difluorophenyl)-2-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-(3-bromo-2,6-difluorophenyl)-2-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136767104 |
| Molecular Formula | C11H4BrF5N2O |
| Molecular Weight | 355.06 g/mol |
| Exact Mass | 353.94 |
| IUPAC Name | 4-(3-bromo-2,6-difluorophenyl)-2-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(-c2c(F)ccc(Br)c2F)nc(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C11H4BrF5N2O/c12-4-1-2-5(13)8(9(4)14)6-3-7(20)19-10(18-6)11(15,16)17/h1-3H,(H,18,19,20) |
| InChIKey | BEMWXIJFQBJPBU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.06 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|