C10H5F4N3O — CID 136802824
4-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 136802824) has the molecular formula C10H5F4N3O and a molecular weight of 259.16 g/mol. Its IUPAC name is 4-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136802824 |
| Molecular Formula | C10H5F4N3O |
| Molecular Weight | 259.16 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 4-(5-fluoro-3-pyridinyl)-2-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(-c2cncc(F)c2)nc(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C10H5F4N3O/c11-6-1-5(3-15-4-6)7-2-8(18)17-9(16-7)10(12,13)14/h1-4H,(H,16,17,18) |
| InChIKey | GBLKCFMPRSHKSE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.16 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |