C9H5F3N4O — CID 137000861
4-pyrimidin-5-yl-2-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 137000861) has the molecular formula C9H5F3N4O and a molecular weight of 242.16 g/mol. Its IUPAC name is 4-pyrimidin-5-yl-2-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-pyrimidin-5-yl-2-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137000861 |
| Molecular Formula | C9H5F3N4O |
| Molecular Weight | 242.16 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 4-pyrimidin-5-yl-2-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(-c2cncnc2)nc(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C9H5F3N4O/c10-9(11,12)8-15-6(1-7(17)16-8)5-2-13-4-14-3-5/h1-4H,(H,15,16,17) |
| InChIKey | LRFUECFARUDKSO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.16 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |