C14H14F2N2O — CID 136769942
4-(2,6-difluoro-3-methylphenyl)-2-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 136769942) has the molecular formula C14H14F2N2O and a molecular weight of 264.27 g/mol. Its IUPAC name is 4-(2,6-difluoro-3-methylphenyl)-2-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 4-(2,6-difluoro-3-methylphenyl)-2-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136769942 |
| Molecular Formula | C14H14F2N2O |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 4-(2,6-difluoro-3-methylphenyl)-2-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | Cc1ccc(F)c(-c2cc(=O)[nH]c(C(C)C)n2)c1F |
| InChI | InChI=1S/C14H14F2N2O/c1-7(2)14-17-10(6-11(19)18-14)12-9(15)5-4-8(3)13(12)16/h4-7H,1-3H3,(H,17,18,19) |
| InChIKey | SXZSWSOOYTWTLI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |