C22H22N2O6S — CID 10694487
methyl 3-[1-(benzenesulfonyl)pyrrol-3-yl]-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 10694487) has the molecular formula C22H22N2O6S and a molecular weight of 442.49 g/mol. Its IUPAC name is methyl 3-[1-(benzenesulfonyl)pyrrol-3-yl]-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | methyl 3-[1-(benzenesulfonyl)pyrrol-3-yl]-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 10694487 |
| Molecular Formula | C22H22N2O6S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | methyl 3-[1-(benzenesulfonyl)pyrrol-3-yl]-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | COC(=O)C(Cc1ccn(S(=O)(=O)c2ccccc2)c1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H22N2O6S/c1-29-21(25)20(23-22(26)30-16-17-8-4-2-5-9-17)14-18-12-13-24(15-18)31(27,28)19-10-6-3-7-11-19/h2-13,15,20H,14,16H2,1H3,(H,23,26) |
| InChIKey | DZVVXIBTWSWMGJ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |