C13H16BrF2N — CID 106944871
1-(3-bromo-2,6-difluorophenyl)-2-cyclobutyl-N-methylethanamine (PubChem CID 106944871) has the molecular formula C13H16BrF2N and a molecular weight of 304.18 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-2-cyclobutyl-N-methylethanamine.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-2-cyclobutyl-N-methylethanamine |
|---|---|
| PubChem CID | 106944871 |
| Molecular Formula | C13H16BrF2N |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-2-cyclobutyl-N-methylethanamine |
| SMILES | CNC(CC1CCC1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H16BrF2N/c1-17-11(7-8-3-2-4-8)12-10(15)6-5-9(14)13(12)16/h5-6,8,11,17H,2-4,7H2,1H3 |
| InChIKey | URNKYFYMFFMJRF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|