C29H34N2O2 — CID 10694513
ethyl 1-propan-2-yl-4-tritylpiperazine-2-carboxylate (PubChem CID 10694513) has the molecular formula C29H34N2O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is ethyl 1-propan-2-yl-4-tritylpiperazine-2-carboxylate.
| Compound Name | ethyl 1-propan-2-yl-4-tritylpiperazine-2-carboxylate |
|---|---|
| PubChem CID | 10694513 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | ethyl 1-propan-2-yl-4-tritylpiperazine-2-carboxylate |
| SMILES | CCOC(=O)C1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CCN1C(C)C |
| InChI | InChI=1S/C29H34N2O2/c1-4-33-28(32)27-22-30(20-21-31(27)23(2)3)29(24-14-8-5-9-15-24,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-19,23,27H,4,20-22H2,1-3H3 |
| InChIKey | OXCFGNCKNNJUKY-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|