C15H8BrF3OS — CID 106945171
(3-bromo-2,6-difluorophenyl)-(6-fluoro-1-benzothiophen-2-yl)methanol (PubChem CID 106945171) has the molecular formula C15H8BrF3OS and a molecular weight of 373.19 g/mol. Its IUPAC name is (3-bromo-2,6-difluorophenyl)-(6-fluoro-1-benzothiophen-2-yl)methanol.
| Compound Name | (3-bromo-2,6-difluorophenyl)-(6-fluoro-1-benzothiophen-2-yl)methanol |
|---|---|
| PubChem CID | 106945171 |
| Molecular Formula | C15H8BrF3OS |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | (3-bromo-2,6-difluorophenyl)-(6-fluoro-1-benzothiophen-2-yl)methanol |
| SMILES | OC(c1cc2ccc(F)cc2s1)c1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H8BrF3OS/c16-9-3-4-10(18)13(14(9)19)15(20)12-5-7-1-2-8(17)6-11(7)21-12/h1-6,15,20H |
| InChIKey | STXBQPZWDLURCS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|