C15H8Br3FS — CID 81104395
2-[bromo-(2,5-dibromophenyl)methyl]-6-fluoro-1-benzothiophene (PubChem CID 81104395) has the molecular formula C15H8Br3FS and a molecular weight of 479.01 g/mol. Its IUPAC name is 2-[bromo-(2,5-dibromophenyl)methyl]-6-fluoro-1-benzothiophene.
| Compound Name | 2-[bromo-(2,5-dibromophenyl)methyl]-6-fluoro-1-benzothiophene |
|---|---|
| PubChem CID | 81104395 |
| Molecular Formula | C15H8Br3FS |
| Molecular Weight | 479.01 g/mol |
| Exact Mass | 475.79 |
| IUPAC Name | 2-[bromo-(2,5-dibromophenyl)methyl]-6-fluoro-1-benzothiophene |
| SMILES | Fc1ccc2cc(C(Br)c3cc(Br)ccc3Br)sc2c1 |
| InChI | InChI=1S/C15H8Br3FS/c16-9-2-4-12(17)11(6-9)15(18)14-5-8-1-3-10(19)7-13(8)20-14/h1-7,15H |
| InChIKey | GVYVCBUGMCBYGU-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.01 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|