C16H12BrF2NS — CID 115844575
2-(4-bromo-2-fluorophenyl)-1-(6-fluoro-1-benzothiophen-2-yl)ethanamine (PubChem CID 115844575) has the molecular formula C16H12BrF2NS and a molecular weight of 368.25 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-1-(6-fluoro-1-benzothiophen-2-yl)ethanamine.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-1-(6-fluoro-1-benzothiophen-2-yl)ethanamine |
|---|---|
| PubChem CID | 115844575 |
| Molecular Formula | C16H12BrF2NS |
| Molecular Weight | 368.25 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-1-(6-fluoro-1-benzothiophen-2-yl)ethanamine |
| SMILES | NC(Cc1ccc(Br)cc1F)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C16H12BrF2NS/c17-11-3-1-9(13(19)7-11)5-14(20)16-6-10-2-4-12(18)8-15(10)21-16/h1-4,6-8,14H,5,20H2 |
| InChIKey | UDSOZQRQCQYICF-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.25 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |