C11H12FNS — CID 114979546
1-(6-fluoro-1-benzothiophen-2-yl)propan-1-amine (PubChem CID 114979546) has the molecular formula C11H12FNS and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-(6-fluoro-1-benzothiophen-2-yl)propan-1-amine.
| Compound Name | 1-(6-fluoro-1-benzothiophen-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 114979546 |
| Molecular Formula | C11H12FNS |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 1-(6-fluoro-1-benzothiophen-2-yl)propan-1-amine |
| SMILES | CCC(N)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C11H12FNS/c1-2-9(13)11-5-7-3-4-8(12)6-10(7)14-11/h3-6,9H,2,13H2,1H3 |
| InChIKey | YXHMNWLJUQXPSN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |