C30H37NO2 — CID 10694563
(6R)-6-[benzhydryl-[(1R)-2-hydroxy-1-phenylethyl]amino]nonan-2-one (PubChem CID 10694563) has the molecular formula C30H37NO2 and a molecular weight of 443.63 g/mol. Its IUPAC name is (6R)-6-[benzhydryl-[(1R)-2-hydroxy-1-phenylethyl]amino]nonan-2-one.
| Compound Name | (6R)-6-[benzhydryl-[(1R)-2-hydroxy-1-phenylethyl]amino]nonan-2-one |
|---|---|
| PubChem CID | 10694563 |
| Molecular Formula | C30H37NO2 |
| Molecular Weight | 443.63 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | (6R)-6-[benzhydryl-[(1R)-2-hydroxy-1-phenylethyl]amino]nonan-2-one |
| SMILES | CCC[C@H](CCCC(C)=O)N(C(c1ccccc1)c1ccccc1)[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C30H37NO2/c1-3-14-28(22-13-15-24(2)33)31(29(23-32)25-16-7-4-8-17-25)30(26-18-9-5-10-19-26)27-20-11-6-12-21-27/h4-12,16-21,28-30,32H,3,13-15,22-23H2,1-2H3/t28-,29+/m1/s1 |
| InChIKey | VCAPPEWNDAOTOU-WDYNHAJCSA-N |
| XLogP | 6.74 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.63 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |