C27H27NOS — CID 10409506
(2R)-2-[benzhydryl-[(1R)-1-thiophen-2-ylethyl]amino]-2-phenylethanol (PubChem CID 10409506) has the molecular formula C27H27NOS and a molecular weight of 413.59 g/mol. Its IUPAC name is (2R)-2-[benzhydryl-[(1R)-1-thiophen-2-ylethyl]amino]-2-phenylethanol.
| Compound Name | (2R)-2-[benzhydryl-[(1R)-1-thiophen-2-ylethyl]amino]-2-phenylethanol |
|---|---|
| PubChem CID | 10409506 |
| Molecular Formula | C27H27NOS |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (2R)-2-[benzhydryl-[(1R)-1-thiophen-2-ylethyl]amino]-2-phenylethanol |
| SMILES | C[C@H](c1cccs1)N(C(c1ccccc1)c1ccccc1)[C@@H](CO)c1ccccc1 |
| InChI | InChI=1S/C27H27NOS/c1-21(26-18-11-19-30-26)28(25(20-29)22-12-5-2-6-13-22)27(23-14-7-3-8-15-23)24-16-9-4-10-17-24/h2-19,21,25,27,29H,20H2,1H3/t21-,25+/m1/s1 |
| InChIKey | KYMHVPIAYOIMGJ-BWKNWUBXSA-N |
| XLogP | 6.63 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |