C18H26N2S — CID 62430658
N-methyl-1-phenyl-N'-propyl-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine (PubChem CID 62430658) has the molecular formula C18H26N2S and a molecular weight of 302.49 g/mol. Its IUPAC name is N-methyl-1-phenyl-N'-propyl-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine.
| Compound Name | N-methyl-1-phenyl-N'-propyl-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62430658 |
| Molecular Formula | C18H26N2S |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | N-methyl-1-phenyl-N'-propyl-N-(1-thiophen-2-ylethyl)ethane-1,2-diamine |
| SMILES | CCCNCC(c1ccccc1)N(C)C(C)c1cccs1 |
| InChI | InChI=1S/C18H26N2S/c1-4-12-19-14-17(16-9-6-5-7-10-16)20(3)15(2)18-11-8-13-21-18/h5-11,13,15,17,19H,4,12,14H2,1-3H3 |
| InChIKey | LJJQOUSNXMOUEM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|