C16H25F3N2 — CID 62426442
1-phenyl-N-propan-2-yl-N'-propyl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine (PubChem CID 62426442) has the molecular formula C16H25F3N2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-phenyl-N-propan-2-yl-N'-propyl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine.
| Compound Name | 1-phenyl-N-propan-2-yl-N'-propyl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 62426442 |
| Molecular Formula | C16H25F3N2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 1-phenyl-N-propan-2-yl-N'-propyl-N-(2,2,2-trifluoroethyl)ethane-1,2-diamine |
| SMILES | CCCNCC(c1ccccc1)N(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C16H25F3N2/c1-4-10-20-11-15(14-8-6-5-7-9-14)21(13(2)3)12-16(17,18)19/h5-9,13,15,20H,4,10-12H2,1-3H3 |
| InChIKey | JKOVOKYBQHXPSX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|