C16H18O4 — CID 106945818
methyl 5-(1-hydroxy-1-phenylbutyl)furan-2-carboxylate (PubChem CID 106945818) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is methyl 5-(1-hydroxy-1-phenylbutyl)furan-2-carboxylate.
| Compound Name | methyl 5-(1-hydroxy-1-phenylbutyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 106945818 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | methyl 5-(1-hydroxy-1-phenylbutyl)furan-2-carboxylate |
| SMILES | CCCC(O)(c1ccccc1)c1ccc(C(=O)OC)o1 |
| InChI | InChI=1S/C16H18O4/c1-3-11-16(18,12-7-5-4-6-8-12)14-10-9-13(20-14)15(17)19-2/h4-10,18H,3,11H2,1-2H3 |
| InChIKey | CLHWJOIKEFQIJW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |