C19H17FN6O4S — CID 10694589
1-[[4-(4-fluorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol (PubChem CID 10694589) has the molecular formula C19H17FN6O4S and a molecular weight of 444.45 g/mol. Its IUPAC name is 1-[[4-(4-fluorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol.
| Compound Name | 1-[[4-(4-fluorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 10694589 |
| Molecular Formula | C19H17FN6O4S |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 1-[[4-(4-fluorophenyl)-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-(2-methyl-5-nitroimidazol-1-yl)propan-2-ol |
| SMILES | Cc1ncc([N+](=O)[O-])n1CC(O)CSc1nnc(-c2ccco2)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C19H17FN6O4S/c1-12-21-9-17(26(28)29)24(12)10-15(27)11-31-19-23-22-18(16-3-2-8-30-16)25(19)14-6-4-13(20)5-7-14/h2-9,15,27H,10-11H2,1H3 |
| InChIKey | MZDSGOKDWSVOCP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|