C16H16F3N7O3S — CID 71834116
N-[3-butylsulfanyl-5-(trifluoromethyl)-1,2,4-triazol-4-yl]-1-[5-[(4-nitropyrazol-1-yl)methyl]furan-2-yl]methanimine (PubChem CID 71834116) has the molecular formula C16H16F3N7O3S and a molecular weight of 443.41 g/mol. Its IUPAC name is N-[3-butylsulfanyl-5-(trifluoromethyl)-1,2,4-triazol-4-yl]-1-[5-[(4-nitropyrazol-1-yl)methyl]furan-2-yl]methanimine.
| Compound Name | N-[3-butylsulfanyl-5-(trifluoromethyl)-1,2,4-triazol-4-yl]-1-[5-[(4-nitropyrazol-1-yl)methyl]furan-2-yl]methanimine |
|---|---|
| PubChem CID | 71834116 |
| Molecular Formula | C16H16F3N7O3S |
| Molecular Weight | 443.41 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | N-[3-butylsulfanyl-5-(trifluoromethyl)-1,2,4-triazol-4-yl]-1-[5-[(4-nitropyrazol-1-yl)methyl]furan-2-yl]methanimine |
| SMILES | CCCCSc1nnc(C(F)(F)F)n1N=Cc1ccc(Cn2cc([N+](=O)[O-])cn2)o1 |
| InChI | InChI=1S/C16H16F3N7O3S/c1-2-3-6-30-15-23-22-14(16(17,18)19)25(15)21-8-12-4-5-13(29-12)10-24-9-11(7-20-24)26(27)28/h4-5,7-9H,2-3,6,10H2,1H3 |
| InChIKey | NEGGTRIEPGKASJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 117.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|