C12H16O4 — CID 106946107
5-(3-ethyl-1-hydroxycyclopentyl)furan-2-carboxylic acid (PubChem CID 106946107) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is 5-(3-ethyl-1-hydroxycyclopentyl)furan-2-carboxylic acid.
| Compound Name | 5-(3-ethyl-1-hydroxycyclopentyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106946107 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 5-(3-ethyl-1-hydroxycyclopentyl)furan-2-carboxylic acid |
| SMILES | CCC1CCC(O)(c2ccc(C(=O)O)o2)C1 |
| InChI | InChI=1S/C12H16O4/c1-2-8-5-6-12(15,7-8)10-4-3-9(16-10)11(13)14/h3-4,8,15H,2,5-7H2,1H3,(H,13,14) |
| InChIKey | XMGNETYYIMNRHI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |