C13H18O5 — CID 106946391
methyl 5-(1-hydroxy-4-methoxycyclohexyl)furan-2-carboxylate (PubChem CID 106946391) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is methyl 5-(1-hydroxy-4-methoxycyclohexyl)furan-2-carboxylate.
| Compound Name | methyl 5-(1-hydroxy-4-methoxycyclohexyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 106946391 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | methyl 5-(1-hydroxy-4-methoxycyclohexyl)furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C2(O)CCC(OC)CC2)o1 |
| InChI | InChI=1S/C13H18O5/c1-16-9-5-7-13(15,8-6-9)11-4-3-10(18-11)12(14)17-2/h3-4,9,15H,5-8H2,1-2H3 |
| InChIKey | OENRSOLCBWDGOY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |