C11H14O4 — CID 106946497
methyl 5-(1-hydroxy-3-methylcyclobutyl)furan-2-carboxylate (PubChem CID 106946497) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is methyl 5-(1-hydroxy-3-methylcyclobutyl)furan-2-carboxylate.
| Compound Name | methyl 5-(1-hydroxy-3-methylcyclobutyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 106946497 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | methyl 5-(1-hydroxy-3-methylcyclobutyl)furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(C2(O)CC(C)C2)o1 |
| InChI | InChI=1S/C11H14O4/c1-7-5-11(13,6-7)9-4-3-8(15-9)10(12)14-2/h3-4,7,13H,5-6H2,1-2H3 |
| InChIKey | MHVDBDUWDUVOEW-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |