C12H11NO4 — CID 106947245
5-(1-hydroxy-2-pyridin-3-ylethyl)furan-2-carboxylic acid (PubChem CID 106947245) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 5-(1-hydroxy-2-pyridin-3-ylethyl)furan-2-carboxylic acid.
| Compound Name | 5-(1-hydroxy-2-pyridin-3-ylethyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106947245 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 5-(1-hydroxy-2-pyridin-3-ylethyl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(O)Cc2cccnc2)o1 |
| InChI | InChI=1S/C12H11NO4/c14-9(6-8-2-1-5-13-7-8)10-3-4-11(17-10)12(15)16/h1-5,7,9,14H,6H2,(H,15,16) |
| InChIKey | QWKJWCHLXYPWDZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |