C13H14N2O3 — CID 81404845
5-[[[(1R)-1-pyridin-3-ylethyl]amino]methyl]furan-2-carboxylic acid (PubChem CID 81404845) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 5-[[[(1R)-1-pyridin-3-ylethyl]amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[[(1R)-1-pyridin-3-ylethyl]amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 81404845 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 5-[[[(1R)-1-pyridin-3-ylethyl]amino]methyl]furan-2-carboxylic acid |
| SMILES | C[C@@H](NCc1ccc(C(=O)O)o1)c1cccnc1 |
| InChI | InChI=1S/C13H14N2O3/c1-9(10-3-2-6-14-7-10)15-8-11-4-5-12(18-11)13(16)17/h2-7,9,15H,8H2,1H3,(H,16,17)/t9-/m1/s1 |
| InChIKey | QDPKPFNFWQZMSY-SECBINFHSA-N |
| XLogP | 2.22 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |