C14H16N2O2S — CID 82888377
2-[5-[[[(1S)-1-pyridin-3-ylethyl]amino]methyl]thiophen-2-yl]acetic acid (PubChem CID 82888377) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 2-[5-[[[(1S)-1-pyridin-3-ylethyl]amino]methyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[[[(1S)-1-pyridin-3-ylethyl]amino]methyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 82888377 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 2-[5-[[[(1S)-1-pyridin-3-ylethyl]amino]methyl]thiophen-2-yl]acetic acid |
| SMILES | C[C@H](NCc1ccc(CC(=O)O)s1)c1cccnc1 |
| InChI | InChI=1S/C14H16N2O2S/c1-10(11-3-2-6-15-8-11)16-9-13-5-4-12(19-13)7-14(17)18/h2-6,8,10,16H,7,9H2,1H3,(H,17,18)/t10-/m0/s1 |
| InChIKey | IOUCRCSSBCJEOR-JTQLQIEISA-N |
| XLogP | 2.62 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |