C12H15N3O2S — CID 114158445
2-[5-[[1-(1H-pyrazol-4-yl)ethylamino]methyl]thiophen-2-yl]acetic acid (PubChem CID 114158445) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 2-[5-[[1-(1H-pyrazol-4-yl)ethylamino]methyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[[1-(1H-pyrazol-4-yl)ethylamino]methyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 114158445 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-[5-[[1-(1H-pyrazol-4-yl)ethylamino]methyl]thiophen-2-yl]acetic acid |
| SMILES | CC(NCc1ccc(CC(=O)O)s1)c1cn[nH]c1 |
| InChI | InChI=1S/C12H15N3O2S/c1-8(9-5-14-15-6-9)13-7-11-3-2-10(18-11)4-12(16)17/h2-3,5-6,8,13H,4,7H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | WEVGJXIFDGUBOG-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |