C12H16O5 — CID 106947334
5-[1-hydroxy-3-(oxolan-2-yl)propyl]furan-2-carboxylic acid (PubChem CID 106947334) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is 5-[1-hydroxy-3-(oxolan-2-yl)propyl]furan-2-carboxylic acid.
| Compound Name | 5-[1-hydroxy-3-(oxolan-2-yl)propyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106947334 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 5-[1-hydroxy-3-(oxolan-2-yl)propyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(C(O)CCC2CCCO2)o1 |
| InChI | InChI=1S/C12H16O5/c13-9(4-3-8-2-1-7-16-8)10-5-6-11(17-10)12(14)15/h5-6,8-9,13H,1-4,7H2,(H,14,15) |
| InChIKey | OEZQDEVQRHZTBG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |