C14H20N2O4 — CID 97086861
2-N-[(2S)-4-[(2R)-oxolan-2-yl]butan-2-yl]furan-2,5-dicarboxamide (PubChem CID 97086861) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-N-[(2S)-4-[(2R)-oxolan-2-yl]butan-2-yl]furan-2,5-dicarboxamide.
| Compound Name | 2-N-[(2S)-4-[(2R)-oxolan-2-yl]butan-2-yl]furan-2,5-dicarboxamide |
|---|---|
| PubChem CID | 97086861 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-N-[(2S)-4-[(2R)-oxolan-2-yl]butan-2-yl]furan-2,5-dicarboxamide |
| SMILES | C[C@@H](CC[C@@H]1CCCO1)NC(=O)c1ccc(C(N)=O)o1 |
| InChI | InChI=1S/C14H20N2O4/c1-9(4-5-10-3-2-8-19-10)16-14(18)12-7-6-11(20-12)13(15)17/h6-7,9-10H,2-5,8H2,1H3,(H2,15,17)(H,16,18)/t9-,10-/m0/s1 |
| InChIKey | LGDWSBGNVGRKLO-UWVGGRQHSA-N |
| XLogP | 1.46 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |