C16H21N3O2 — CID 94820916
N-[(2R)-4-[(2R)-oxolan-2-yl]butan-2-yl]-3H-benzimidazole-5-carboxamide (PubChem CID 94820916) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-[(2R)-4-[(2R)-oxolan-2-yl]butan-2-yl]-3H-benzimidazole-5-carboxamide.
| Compound Name | N-[(2R)-4-[(2R)-oxolan-2-yl]butan-2-yl]-3H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 94820916 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-[(2R)-4-[(2R)-oxolan-2-yl]butan-2-yl]-3H-benzimidazole-5-carboxamide |
| SMILES | C[C@H](CC[C@@H]1CCCO1)NC(=O)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C16H21N3O2/c1-11(4-6-13-3-2-8-21-13)19-16(20)12-5-7-14-15(9-12)18-10-17-14/h5,7,9-11,13H,2-4,6,8H2,1H3,(H,17,18)(H,19,20)/t11-,13+/m1/s1 |
| InChIKey | SZIQIBCCFYJDKX-YPMHNXCESA-N |
| XLogP | 2.64 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |