C15H20ClNO3 — CID 94820204
3-chloro-4-hydroxy-N-[(2S)-4-[(2S)-oxolan-2-yl]butan-2-yl]benzamide (PubChem CID 94820204) has the molecular formula C15H20ClNO3 and a molecular weight of 297.78 g/mol. Its IUPAC name is 3-chloro-4-hydroxy-N-[(2S)-4-[(2S)-oxolan-2-yl]butan-2-yl]benzamide.
| Compound Name | 3-chloro-4-hydroxy-N-[(2S)-4-[(2S)-oxolan-2-yl]butan-2-yl]benzamide |
|---|---|
| PubChem CID | 94820204 |
| Molecular Formula | C15H20ClNO3 |
| Molecular Weight | 297.78 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-chloro-4-hydroxy-N-[(2S)-4-[(2S)-oxolan-2-yl]butan-2-yl]benzamide |
| SMILES | C[C@@H](CC[C@H]1CCCO1)NC(=O)c1ccc(O)c(Cl)c1 |
| InChI | InChI=1S/C15H20ClNO3/c1-10(4-6-12-3-2-8-20-12)17-15(19)11-5-7-14(18)13(16)9-11/h5,7,9-10,12,18H,2-4,6,8H2,1H3,(H,17,19)/t10-,12+/m0/s1 |
| InChIKey | MZVOFXCNSJBYNE-CMPLNLGQSA-N |
| XLogP | 3.12 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.78 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |