C25H23NO5S — CID 10694806
benzyl (2S,3S)-3-benzyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carboxylate (PubChem CID 10694806) has the molecular formula C25H23NO5S and a molecular weight of 449.53 g/mol. Its IUPAC name is benzyl (2S,3S)-3-benzyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carboxylate.
| Compound Name | benzyl (2S,3S)-3-benzyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carboxylate |
|---|---|
| PubChem CID | 10694806 |
| Molecular Formula | C25H23NO5S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | benzyl (2S,3S)-3-benzyl-1-(4-methylphenyl)sulfonyl-4-oxoazetidine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)[C@@H](Cc3ccccc3)[C@H]2C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H23NO5S/c1-18-12-14-21(15-13-18)32(29,30)26-23(25(28)31-17-20-10-6-3-7-11-20)22(24(26)27)16-19-8-4-2-5-9-19/h2-15,22-23H,16-17H2,1H3/t22-,23-/m0/s1 |
| InChIKey | XQYOMIATGPFTFU-GOTSBHOMSA-N |
| XLogP | 3.50 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |